C26H28N2O6S — CID 139895016
tert-butyl 2-[N-(4-methoxyphenyl)sulfonyl-2-[(Z)-2-(1-oxidopyridin-1-ium-3-yl)ethenyl]anilino]acetate (PubChem CID 139895016) has the molecular formula C26H28N2O6S and a molecular weight of 496.59 g/mol. Its IUPAC name is tert-butyl 2-[N-(4-methoxyphenyl)sulfonyl-2-[(Z)-2-(1-oxidopyridin-1-ium-3-yl)ethenyl]anilino]acetate.
| Compound Name | tert-butyl 2-[N-(4-methoxyphenyl)sulfonyl-2-[(Z)-2-(1-oxidopyridin-1-ium-3-yl)ethenyl]anilino]acetate |
|---|---|
| PubChem CID | 139895016 |
| Molecular Formula | C26H28N2O6S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | tert-butyl 2-[N-(4-methoxyphenyl)sulfonyl-2-[(Z)-2-(1-oxidopyridin-1-ium-3-yl)ethenyl]anilino]acetate |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)OC(C)(C)C)c2ccccc2/C=C\c2ccc[n+]([O-])c2)cc1 |
| InChI | InChI=1S/C26H28N2O6S/c1-26(2,3)34-25(29)19-28(35(31,32)23-15-13-22(33-4)14-16-23)24-10-6-5-9-21(24)12-11-20-8-7-17-27(30)18-20/h5-18H,19H2,1-4H3/b12-11- |
| InChIKey | SNCBODZUEQUAKJ-QXMHVHEDSA-N |
| XLogP | 4.04 |
| TPSA | 99.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|