C26H25N3O4S — CID 139895021
tert-butyl 2-[N-(4-cyanophenyl)sulfonyl-2-(2-pyridin-2-ylethenyl)anilino]acetate (PubChem CID 139895021) has the molecular formula C26H25N3O4S and a molecular weight of 475.57 g/mol. Its IUPAC name is tert-butyl 2-[N-(4-cyanophenyl)sulfonyl-2-(2-pyridin-2-ylethenyl)anilino]acetate.
| Compound Name | tert-butyl 2-[N-(4-cyanophenyl)sulfonyl-2-(2-pyridin-2-ylethenyl)anilino]acetate |
|---|---|
| PubChem CID | 139895021 |
| Molecular Formula | C26H25N3O4S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | tert-butyl 2-[N-(4-cyanophenyl)sulfonyl-2-(2-pyridin-2-ylethenyl)anilino]acetate |
| SMILES | CC(C)(C)OC(=O)CN(c1ccccc1C=Cc1ccccn1)S(=O)(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C26H25N3O4S/c1-26(2,3)33-25(30)19-29(34(31,32)23-15-11-20(18-27)12-16-23)24-10-5-4-8-21(24)13-14-22-9-6-7-17-28-22/h4-17H,19H2,1-3H3 |
| InChIKey | AATOYUJPGASHKL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 100.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |