C19H20N2O4S — CID 150196264
tert-butyl N-(benzenesulfonyl)-N-[(4-cyanophenyl)methyl]carbamate (PubChem CID 150196264) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is tert-butyl N-(benzenesulfonyl)-N-[(4-cyanophenyl)methyl]carbamate.
| Compound Name | tert-butyl N-(benzenesulfonyl)-N-[(4-cyanophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 150196264 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | tert-butyl N-(benzenesulfonyl)-N-[(4-cyanophenyl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccc(C#N)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O4S/c1-19(2,3)25-18(22)21(14-16-11-9-15(13-20)10-12-16)26(23,24)17-7-5-4-6-8-17/h4-12H,14H2,1-3H3 |
| InChIKey | FONDESMAJYIBEV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |