C17H24N2O2 — CID 86866922
tert-butyl 2-[(4-cyanophenyl)methyl-propan-2-ylamino]acetate (PubChem CID 86866922) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is tert-butyl 2-[(4-cyanophenyl)methyl-propan-2-ylamino]acetate.
| Compound Name | tert-butyl 2-[(4-cyanophenyl)methyl-propan-2-ylamino]acetate |
|---|---|
| PubChem CID | 86866922 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | tert-butyl 2-[(4-cyanophenyl)methyl-propan-2-ylamino]acetate |
| SMILES | CC(C)N(CC(=O)OC(C)(C)C)Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H24N2O2/c1-13(2)19(12-16(20)21-17(3,4)5)11-15-8-6-14(10-18)7-9-15/h6-9,13H,11-12H2,1-5H3 |
| InChIKey | SKUAHOHXNCILKZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |