C21H33NO4 — CID 143819489
3-[(4-cyanophenyl)methyl]-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid;ethane (PubChem CID 143819489) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is 3-[(4-cyanophenyl)methyl]-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid;ethane.
| Compound Name | 3-[(4-cyanophenyl)methyl]-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid;ethane |
|---|---|
| PubChem CID | 143819489 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 3-[(4-cyanophenyl)methyl]-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid;ethane |
| SMILES | CC.CC.CC(C)(C)OC(=O)CC(CC(=O)O)Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H21NO4.2C2H6/c1-17(2,3)22-16(21)10-14(9-15(19)20)8-12-4-6-13(11-18)7-5-12;2*1-2/h4-7,14H,8-10H2,1-3H3,(H,19,20);2*1-2H3 |
| InChIKey | KMLPLZLJIRQXMN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |