C15H22O2S — CID 157400335
tert-butyl (3S)-3-benzyl-4-sulfanylbutanoate (PubChem CID 157400335) has the molecular formula C15H22O2S and a molecular weight of 266.41 g/mol. Its IUPAC name is tert-butyl (3S)-3-benzyl-4-sulfanylbutanoate.
| Compound Name | tert-butyl (3S)-3-benzyl-4-sulfanylbutanoate |
|---|---|
| PubChem CID | 157400335 |
| Molecular Formula | C15H22O2S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | tert-butyl (3S)-3-benzyl-4-sulfanylbutanoate |
| SMILES | CC(C)(C)OC(=O)C[C@@H](CS)Cc1ccccc1 |
| InChI | InChI=1S/C15H22O2S/c1-15(2,3)17-14(16)10-13(11-18)9-12-7-5-4-6-8-12/h4-8,13,18H,9-11H2,1-3H3/t13-/m0/s1 |
| InChIKey | ICGNFKKBJKWZBK-ZDUSSCGKSA-N |
| XLogP | 3.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|