C16H22Cl2O2 — CID 122388224
tert-butyl (3R,5S)-3,5-dichloro-6-phenylhexanoate (PubChem CID 122388224) has the molecular formula C16H22Cl2O2 and a molecular weight of 317.26 g/mol. Its IUPAC name is tert-butyl (3R,5S)-3,5-dichloro-6-phenylhexanoate.
| Compound Name | tert-butyl (3R,5S)-3,5-dichloro-6-phenylhexanoate |
|---|---|
| PubChem CID | 122388224 |
| Molecular Formula | C16H22Cl2O2 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | tert-butyl (3R,5S)-3,5-dichloro-6-phenylhexanoate |
| SMILES | CC(C)(C)OC(=O)C[C@@H](Cl)C[C@@H](Cl)Cc1ccccc1 |
| InChI | InChI=1S/C16H22Cl2O2/c1-16(2,3)20-15(19)11-14(18)10-13(17)9-12-7-5-4-6-8-12/h4-8,13-14H,9-11H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | KAAWRWMIIKKOHA-KBPBESRZSA-N |
| XLogP | 4.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|