C19H28O5 — CID 58234339
7-O-benzyl 1-O-tert-butyl (3R)-3-(hydroxymethyl)heptanedioate (PubChem CID 58234339) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is 7-O-benzyl 1-O-tert-butyl (3R)-3-(hydroxymethyl)heptanedioate.
| Compound Name | 7-O-benzyl 1-O-tert-butyl (3R)-3-(hydroxymethyl)heptanedioate |
|---|---|
| PubChem CID | 58234339 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 7-O-benzyl 1-O-tert-butyl (3R)-3-(hydroxymethyl)heptanedioate |
| SMILES | CC(C)(C)OC(=O)C[C@H](CO)CCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H28O5/c1-19(2,3)24-18(22)12-16(13-20)10-7-11-17(21)23-14-15-8-5-4-6-9-15/h4-6,8-9,16,20H,7,10-14H2,1-3H3/t16-/m1/s1 |
| InChIKey | LWOZCNJNUBLLHM-MRXNPFEDSA-N |
| XLogP | 3.24 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |