C19H27NO6 — CID 174442636
2-amino-7-[(2-methylpropan-2-yl)oxy]-7-oxo-3-phenylmethoxycarbonylheptanoic acid (PubChem CID 174442636) has the molecular formula C19H27NO6 and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-amino-7-[(2-methylpropan-2-yl)oxy]-7-oxo-3-phenylmethoxycarbonylheptanoic acid.
| Compound Name | 2-amino-7-[(2-methylpropan-2-yl)oxy]-7-oxo-3-phenylmethoxycarbonylheptanoic acid |
|---|---|
| PubChem CID | 174442636 |
| Molecular Formula | C19H27NO6 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 2-amino-7-[(2-methylpropan-2-yl)oxy]-7-oxo-3-phenylmethoxycarbonylheptanoic acid |
| SMILES | CC(C)(C)OC(=O)CCCC(C(=O)OCc1ccccc1)C(N)C(=O)O |
| InChI | InChI=1S/C19H27NO6/c1-19(2,3)26-15(21)11-7-10-14(16(20)17(22)23)18(24)25-12-13-8-5-4-6-9-13/h4-6,8-9,14,16H,7,10-12,20H2,1-3H3,(H,22,23) |
| InChIKey | GQKHJJJPGSGXIL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |