C16H24ClNO4 — CID 118797500
1-O-benzyl 5-O-tert-butyl 2-aminopentanedioate;hydrochloride (PubChem CID 118797500) has the molecular formula C16H24ClNO4 and a molecular weight of 329.82 g/mol. Its IUPAC name is 1-O-benzyl 5-O-tert-butyl 2-aminopentanedioate;hydrochloride.
| Compound Name | 1-O-benzyl 5-O-tert-butyl 2-aminopentanedioate;hydrochloride |
|---|---|
| PubChem CID | 118797500 |
| Molecular Formula | C16H24ClNO4 |
| Molecular Weight | 329.82 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 1-O-benzyl 5-O-tert-butyl 2-aminopentanedioate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)CCC(N)C(=O)OCc1ccccc1.Cl |
| InChI | InChI=1S/C16H23NO4.ClH/c1-16(2,3)21-14(18)10-9-13(17)15(19)20-11-12-7-5-4-6-8-12;/h4-8,13H,9-11,17H2,1-3H3;1H |
| InChIKey | PZCDXXIAXZLMQY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.82 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |