C18H26N2O6 — CID 174424737
2,3-diamino-6-[(2-methylpropan-2-yl)oxy]-6-oxo-2-phenylmethoxycarbonylhexanoic acid (PubChem CID 174424737) has the molecular formula C18H26N2O6 and a molecular weight of 366.41 g/mol. Its IUPAC name is 2,3-diamino-6-[(2-methylpropan-2-yl)oxy]-6-oxo-2-phenylmethoxycarbonylhexanoic acid.
| Compound Name | 2,3-diamino-6-[(2-methylpropan-2-yl)oxy]-6-oxo-2-phenylmethoxycarbonylhexanoic acid |
|---|---|
| PubChem CID | 174424737 |
| Molecular Formula | C18H26N2O6 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 2,3-diamino-6-[(2-methylpropan-2-yl)oxy]-6-oxo-2-phenylmethoxycarbonylhexanoic acid |
| SMILES | CC(C)(C)OC(=O)CCC(N)C(N)(C(=O)O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H26N2O6/c1-17(2,3)26-14(21)10-9-13(19)18(20,15(22)23)16(24)25-11-12-7-5-4-6-8-12/h4-8,13H,9-11,19-20H2,1-3H3,(H,22,23) |
| InChIKey | FXOANLWUPUAAIF-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 141.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|