C19H26O6 — CID 157475891
1-O-benzyl 4-O-tert-butyl 2-O-methyl (2R)-butane-1,2,4-tricarboxylate (PubChem CID 157475891) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is 1-O-benzyl 4-O-tert-butyl 2-O-methyl (2R)-butane-1,2,4-tricarboxylate.
| Compound Name | 1-O-benzyl 4-O-tert-butyl 2-O-methyl (2R)-butane-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 157475891 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 1-O-benzyl 4-O-tert-butyl 2-O-methyl (2R)-butane-1,2,4-tricarboxylate |
| SMILES | COC(=O)[C@H](CCC(=O)OC(C)(C)C)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H26O6/c1-19(2,3)25-16(20)11-10-15(18(22)23-4)12-17(21)24-13-14-8-6-5-7-9-14/h5-9,15H,10-13H2,1-4H3/t15-/m1/s1 |
| InChIKey | XXDPYHCDMDIJKJ-OAHLLOKOSA-N |
| XLogP | 3.03 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|