C18H26O5 — CID 147082944
1-O-benzyl 4-O-tert-butyl (2S)-2-(3-hydroxypropyl)butanedioate (PubChem CID 147082944) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is 1-O-benzyl 4-O-tert-butyl (2S)-2-(3-hydroxypropyl)butanedioate.
| Compound Name | 1-O-benzyl 4-O-tert-butyl (2S)-2-(3-hydroxypropyl)butanedioate |
|---|---|
| PubChem CID | 147082944 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 1-O-benzyl 4-O-tert-butyl (2S)-2-(3-hydroxypropyl)butanedioate |
| SMILES | CC(C)(C)OC(=O)C[C@H](CCCO)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H26O5/c1-18(2,3)23-16(20)12-15(10-7-11-19)17(21)22-13-14-8-5-4-6-9-14/h4-6,8-9,15,19H,7,10-13H2,1-3H3/t15-/m0/s1 |
| InChIKey | BHGYWZXLTZCWIY-HNNXBMFYSA-N |
| XLogP | 2.85 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |