C22H30N2O5 — CID 160552493
1-O-benzyl 9-O-tert-butyl (3R)-3-(2-diazoacetyl)nonanedioate (PubChem CID 160552493) has the molecular formula C22H30N2O5 and a molecular weight of 402.49 g/mol. Its IUPAC name is 1-O-benzyl 9-O-tert-butyl (3R)-3-(2-diazoacetyl)nonanedioate.
| Compound Name | 1-O-benzyl 9-O-tert-butyl (3R)-3-(2-diazoacetyl)nonanedioate |
|---|---|
| PubChem CID | 160552493 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 1-O-benzyl 9-O-tert-butyl (3R)-3-(2-diazoacetyl)nonanedioate |
| SMILES | CC(C)(C)OC(=O)CCCCC[C@H](CC(=O)OCc1ccccc1)C(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C22H30N2O5/c1-22(2,3)29-20(26)13-9-5-8-12-18(19(25)15-24-23)14-21(27)28-16-17-10-6-4-7-11-17/h4,6-7,10-11,15,18H,5,8-9,12-14,16H2,1-3H3/t18-/m1/s1 |
| InChIKey | XMRCNNYSFSRRER-GOSISDBHSA-N |
| XLogP | 3.90 |
| TPSA | 106.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|