C22H33NO7 — CID 67553066
4-O-tert-butyl 1-O,1-O-diethyl 2-amino-1-phenylmethoxybutane-1,1,4-tricarboxylate (PubChem CID 67553066) has the molecular formula C22H33NO7 and a molecular weight of 423.51 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O,1-O-diethyl 2-amino-1-phenylmethoxybutane-1,1,4-tricarboxylate.
| Compound Name | 4-O-tert-butyl 1-O,1-O-diethyl 2-amino-1-phenylmethoxybutane-1,1,4-tricarboxylate |
|---|---|
| PubChem CID | 67553066 |
| Molecular Formula | C22H33NO7 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 4-O-tert-butyl 1-O,1-O-diethyl 2-amino-1-phenylmethoxybutane-1,1,4-tricarboxylate |
| SMILES | CCOC(=O)C(OCc1ccccc1)(C(=O)OCC)C(N)CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H33NO7/c1-6-27-19(25)22(20(26)28-7-2,29-15-16-11-9-8-10-12-16)17(23)13-14-18(24)30-21(3,4)5/h8-12,17H,6-7,13-15,23H2,1-5H3 |
| InChIKey | MIYLFKYFLVHBSL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|