C14H22N2O3 — CID 174431834
tert-butyl 3,3-diamino-3-phenylmethoxypropanoate (PubChem CID 174431834) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is tert-butyl 3,3-diamino-3-phenylmethoxypropanoate.
| Compound Name | tert-butyl 3,3-diamino-3-phenylmethoxypropanoate |
|---|---|
| PubChem CID | 174431834 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | tert-butyl 3,3-diamino-3-phenylmethoxypropanoate |
| SMILES | CC(C)(C)OC(=O)CC(N)(N)OCc1ccccc1 |
| InChI | InChI=1S/C14H22N2O3/c1-13(2,3)19-12(17)9-14(15,16)18-10-11-7-5-4-6-8-11/h4-8H,9-10,15-16H2,1-3H3 |
| InChIKey | WXHOOQSAWLWAHQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|