C19H25NO8 — CID 140575270
(2R)-2-ethoxycarbonyl-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid (PubChem CID 140575270) has the molecular formula C19H25NO8 and a molecular weight of 395.41 g/mol. Its IUPAC name is (2R)-2-ethoxycarbonyl-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid.
| Compound Name | (2R)-2-ethoxycarbonyl-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 140575270 |
| Molecular Formula | C19H25NO8 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | (2R)-2-ethoxycarbonyl-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid |
| SMILES | CCOC(=O)[C@](CC(=O)OC(C)(C)C)(NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H25NO8/c1-5-26-16(24)19(15(22)23,11-14(21)28-18(2,3)4)20-17(25)27-12-13-9-7-6-8-10-13/h6-10H,5,11-12H2,1-4H3,(H,20,25)(H,22,23)/t19-/m1/s1 |
| InChIKey | LHPODJJNDBQLDJ-LJQANCHMSA-N |
| XLogP | 2.03 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|