C13H14ClNO5 — CID 87094408
(2S)-4-chloro-2-methyl-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid (PubChem CID 87094408) has the molecular formula C13H14ClNO5 and a molecular weight of 299.71 g/mol. Its IUPAC name is (2S)-4-chloro-2-methyl-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid.
| Compound Name | (2S)-4-chloro-2-methyl-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 87094408 |
| Molecular Formula | C13H14ClNO5 |
| Molecular Weight | 299.71 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | (2S)-4-chloro-2-methyl-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid |
| SMILES | C[C@@](CC(=O)Cl)(NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H14ClNO5/c1-13(11(17)18,7-10(14)16)15-12(19)20-8-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H,15,19)(H,17,18)/t13-/m0/s1 |
| InChIKey | DPEOWJNSYNCQPD-ZDUSSCGKSA-N |
| XLogP | 1.91 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.71 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|