C15H19Cl2NO4 — CID 167527436
methyl (2S)-5,5-dichloro-2-methyl-2-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 167527436) has the molecular formula C15H19Cl2NO4 and a molecular weight of 348.23 g/mol. Its IUPAC name is methyl (2S)-5,5-dichloro-2-methyl-2-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | methyl (2S)-5,5-dichloro-2-methyl-2-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 167527436 |
| Molecular Formula | C15H19Cl2NO4 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | methyl (2S)-5,5-dichloro-2-methyl-2-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | COC(=O)[C@](C)(CCC(Cl)Cl)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H19Cl2NO4/c1-15(13(19)21-2,9-8-12(16)17)18-14(20)22-10-11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3,(H,18,20)/t15-/m0/s1 |
| InChIKey | BPMPDFFGLPKEIZ-HNNXBMFYSA-N |
| XLogP | 3.43 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|