C20H21F3N2O4 — CID 3654902
ethyl 3,3,3-trifluoro-2-(4-methylanilino)-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 3654902) has the molecular formula C20H21F3N2O4 and a molecular weight of 410.39 g/mol. Its IUPAC name is ethyl 3,3,3-trifluoro-2-(4-methylanilino)-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | ethyl 3,3,3-trifluoro-2-(4-methylanilino)-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 3654902 |
| Molecular Formula | C20H21F3N2O4 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | ethyl 3,3,3-trifluoro-2-(4-methylanilino)-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | CCOC(=O)C(NC(=O)OCc1ccccc1)(Nc1ccc(C)cc1)C(F)(F)F |
| InChI | InChI=1S/C20H21F3N2O4/c1-3-28-17(26)19(20(21,22)23,24-16-11-9-14(2)10-12-16)25-18(27)29-13-15-7-5-4-6-8-15/h4-12,24H,3,13H2,1-2H3,(H,25,27) |
| InChIKey | UCUKRDGEDXQEHZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|