C17H21F3N2O6 — CID 40560101
ethyl 4-[[(2S)-3-ethoxy-2-(ethoxycarbonylamino)-1,1,1-trifluoro-3-oxopropan-2-yl]amino]benzoate (PubChem CID 40560101) has the molecular formula C17H21F3N2O6 and a molecular weight of 406.36 g/mol. Its IUPAC name is ethyl 4-[[(2S)-3-ethoxy-2-(ethoxycarbonylamino)-1,1,1-trifluoro-3-oxopropan-2-yl]amino]benzoate.
| Compound Name | ethyl 4-[[(2S)-3-ethoxy-2-(ethoxycarbonylamino)-1,1,1-trifluoro-3-oxopropan-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 40560101 |
| Molecular Formula | C17H21F3N2O6 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | ethyl 4-[[(2S)-3-ethoxy-2-(ethoxycarbonylamino)-1,1,1-trifluoro-3-oxopropan-2-yl]amino]benzoate |
| SMILES | CCOC(=O)N[C@@](Nc1ccc(C(=O)OCC)cc1)(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C17H21F3N2O6/c1-4-26-13(23)11-7-9-12(10-8-11)21-16(17(18,19)20,14(24)27-5-2)22-15(25)28-6-3/h7-10,21H,4-6H2,1-3H3,(H,22,25)/t16-/m0/s1 |
| InChIKey | BKZGIBVURIKADK-INIZCTEOSA-N |
| XLogP | 2.84 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|