C15H10F11NO4 — CID 71672336
ethyl 4-[[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl]amino]benzoate (PubChem CID 71672336) has the molecular formula C15H10F11NO4 and a molecular weight of 477.23 g/mol. Its IUPAC name is ethyl 4-[[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl]amino]benzoate.
| Compound Name | ethyl 4-[[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl]amino]benzoate |
|---|---|
| PubChem CID | 71672336 |
| Molecular Formula | C15H10F11NO4 |
| Molecular Weight | 477.23 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | ethyl 4-[[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H10F11NO4/c1-2-30-9(28)7-3-5-8(6-4-7)27-10(29)11(16,13(19,20)21)31-15(25,26)12(17,18)14(22,23)24/h3-6H,2H2,1H3,(H,27,29) |
| InChIKey | BCZCLFSAUXBCPM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.23 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|