C17H23F3N2O4 — CID 40553046
ethyl (2S)-2-acetamido-2-(4-butoxyanilino)-3,3,3-trifluoropropanoate (PubChem CID 40553046) has the molecular formula C17H23F3N2O4 and a molecular weight of 376.38 g/mol. Its IUPAC name is ethyl (2S)-2-acetamido-2-(4-butoxyanilino)-3,3,3-trifluoropropanoate.
| Compound Name | ethyl (2S)-2-acetamido-2-(4-butoxyanilino)-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 40553046 |
| Molecular Formula | C17H23F3N2O4 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | ethyl (2S)-2-acetamido-2-(4-butoxyanilino)-3,3,3-trifluoropropanoate |
| SMILES | CCCCOc1ccc(N[C@](NC(C)=O)(C(=O)OCC)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H23F3N2O4/c1-4-6-11-26-14-9-7-13(8-10-14)22-16(17(18,19)20,21-12(3)23)15(24)25-5-2/h7-10,22H,4-6,11H2,1-3H3,(H,21,23)/t16-/m1/s1 |
| InChIKey | PYNZFQNLFOYVGY-MRXNPFEDSA-N |
| XLogP | 3.24 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|