C19H15F7N2O4 — CID 4228459
ethyl 3,3,3-trifluoro-2-[(2-fluorobenzoyl)amino]-2-[4-(trifluoromethoxy)anilino]propanoate (PubChem CID 4228459) has the molecular formula C19H15F7N2O4 and a molecular weight of 468.33 g/mol. Its IUPAC name is ethyl 3,3,3-trifluoro-2-[(2-fluorobenzoyl)amino]-2-[4-(trifluoromethoxy)anilino]propanoate.
| Compound Name | ethyl 3,3,3-trifluoro-2-[(2-fluorobenzoyl)amino]-2-[4-(trifluoromethoxy)anilino]propanoate |
|---|---|
| PubChem CID | 4228459 |
| Molecular Formula | C19H15F7N2O4 |
| Molecular Weight | 468.33 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | ethyl 3,3,3-trifluoro-2-[(2-fluorobenzoyl)amino]-2-[4-(trifluoromethoxy)anilino]propanoate |
| SMILES | CCOC(=O)C(NC(=O)c1ccccc1F)(Nc1ccc(OC(F)(F)F)cc1)C(F)(F)F |
| InChI | InChI=1S/C19H15F7N2O4/c1-2-31-16(30)17(18(21,22)23,28-15(29)13-5-3-4-6-14(13)20)27-11-7-9-12(10-8-11)32-19(24,25)26/h3-10,27H,2H2,1H3,(H,28,29) |
| InChIKey | SCFVJZRDPFDMFG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|