C19H15F4N3O3S — CID 7035112
ethyl (2R)-2-(1,3-benzothiazol-2-ylamino)-3,3,3-trifluoro-2-[(2-fluorobenzoyl)amino]propanoate (PubChem CID 7035112) has the molecular formula C19H15F4N3O3S and a molecular weight of 441.41 g/mol. Its IUPAC name is ethyl (2R)-2-(1,3-benzothiazol-2-ylamino)-3,3,3-trifluoro-2-[(2-fluorobenzoyl)amino]propanoate.
| Compound Name | ethyl (2R)-2-(1,3-benzothiazol-2-ylamino)-3,3,3-trifluoro-2-[(2-fluorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 7035112 |
| Molecular Formula | C19H15F4N3O3S |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | ethyl (2R)-2-(1,3-benzothiazol-2-ylamino)-3,3,3-trifluoro-2-[(2-fluorobenzoyl)amino]propanoate |
| SMILES | CCOC(=O)[C@@](NC(=O)c1ccccc1F)(Nc1nc2ccccc2s1)C(F)(F)F |
| InChI | InChI=1S/C19H15F4N3O3S/c1-2-29-16(28)18(19(21,22)23,25-15(27)11-7-3-4-8-12(11)20)26-17-24-13-9-5-6-10-14(13)30-17/h3-10H,2H2,1H3,(H,24,26)(H,25,27)/t18-/m1/s1 |
| InChIKey | YNGBNWOBNZMPGJ-GOSISDBHSA-N |
| XLogP | 4.10 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|