C17H16F4N3O3+ — CID 7301057
methyl (2R)-3,3,3-trifluoro-2-[(2-fluorobenzoyl)amino]-2-[(6-methylpyridin-1-ium-2-yl)amino]propanoate (PubChem CID 7301057) has the molecular formula C17H16F4N3O3+ and a molecular weight of 386.33 g/mol. Its IUPAC name is methyl (2R)-3,3,3-trifluoro-2-[(2-fluorobenzoyl)amino]-2-[(6-methylpyridin-1-ium-2-yl)amino]propanoate.
| Compound Name | methyl (2R)-3,3,3-trifluoro-2-[(2-fluorobenzoyl)amino]-2-[(6-methylpyridin-1-ium-2-yl)amino]propanoate |
|---|---|
| PubChem CID | 7301057 |
| Molecular Formula | C17H16F4N3O3+ |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | methyl (2R)-3,3,3-trifluoro-2-[(2-fluorobenzoyl)amino]-2-[(6-methylpyridin-1-ium-2-yl)amino]propanoate |
| SMILES | COC(=O)[C@](NC(=O)c1ccccc1F)(Nc1cccc(C)[nH+]1)C(F)(F)F |
| InChI | InChI=1S/C17H15F4N3O3/c1-10-6-5-9-13(22-10)23-16(15(26)27-2,17(19,20)21)24-14(25)11-7-3-4-8-12(11)18/h3-9H,1-2H3,(H,22,23)(H,24,25)/p+1/t16-/m1/s1 |
| InChIKey | JGZSTIALOXNOCA-MRXNPFEDSA-O |
| XLogP | 2.22 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|