C11H12BrF3N3O3+ — CID 7044215
methyl (2S)-2-acetamido-2-[(5-bromopyridin-1-ium-2-yl)amino]-3,3,3-trifluoropropanoate (PubChem CID 7044215) has the molecular formula C11H12BrF3N3O3+ and a molecular weight of 371.13 g/mol. Its IUPAC name is methyl (2S)-2-acetamido-2-[(5-bromopyridin-1-ium-2-yl)amino]-3,3,3-trifluoropropanoate.
| Compound Name | methyl (2S)-2-acetamido-2-[(5-bromopyridin-1-ium-2-yl)amino]-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 7044215 |
| Molecular Formula | C11H12BrF3N3O3+ |
| Molecular Weight | 371.13 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | methyl (2S)-2-acetamido-2-[(5-bromopyridin-1-ium-2-yl)amino]-3,3,3-trifluoropropanoate |
| SMILES | COC(=O)[C@@](NC(C)=O)(Nc1ccc(Br)c[nH+]1)C(F)(F)F |
| InChI | InChI=1S/C11H11BrF3N3O3/c1-6(19)17-10(9(20)21-2,11(13,14)15)18-8-4-3-7(12)5-16-8/h3-5H,1-2H3,(H,16,18)(H,17,19)/p+1/t10-/m1/s1 |
| InChIKey | ACTCWGQGGHXOAJ-SNVBAGLBSA-O |
| XLogP | 1.24 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.13 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|