C18H19F3N3O4+ — CID 7304229
methyl (2R)-3,3,3-trifluoro-2-[(5-methylpyridin-1-ium-2-yl)amino]-2-[(2-phenoxyacetyl)amino]propanoate (PubChem CID 7304229) has the molecular formula C18H19F3N3O4+ and a molecular weight of 398.36 g/mol. Its IUPAC name is methyl (2R)-3,3,3-trifluoro-2-[(5-methylpyridin-1-ium-2-yl)amino]-2-[(2-phenoxyacetyl)amino]propanoate.
| Compound Name | methyl (2R)-3,3,3-trifluoro-2-[(5-methylpyridin-1-ium-2-yl)amino]-2-[(2-phenoxyacetyl)amino]propanoate |
|---|---|
| PubChem CID | 7304229 |
| Molecular Formula | C18H19F3N3O4+ |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | methyl (2R)-3,3,3-trifluoro-2-[(5-methylpyridin-1-ium-2-yl)amino]-2-[(2-phenoxyacetyl)amino]propanoate |
| SMILES | COC(=O)[C@](NC(=O)COc1ccccc1)(Nc1ccc(C)c[nH+]1)C(F)(F)F |
| InChI | InChI=1S/C18H18F3N3O4/c1-12-8-9-14(22-10-12)23-17(16(26)27-2,18(19,20)21)24-15(25)11-28-13-6-4-3-5-7-13/h3-10H,11H2,1-2H3,(H,22,23)(H,24,25)/p+1/t17-/m1/s1 |
| InChIKey | QIXNRRYZEICCAU-QGZVFWFLSA-O |
| XLogP | 1.85 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|