C29H27F6NO4 — CID 86685890
2-phenoxy-N-[(2S)-1,1,1-trifluoro-4-(4-methylphenyl)-4-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]butan-2-yl]acetamide (PubChem CID 86685890) has the molecular formula C29H27F6NO4 and a molecular weight of 567.53 g/mol. Its IUPAC name is 2-phenoxy-N-[(2S)-1,1,1-trifluoro-4-(4-methylphenyl)-4-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]butan-2-yl]acetamide.
| Compound Name | 2-phenoxy-N-[(2S)-1,1,1-trifluoro-4-(4-methylphenyl)-4-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]butan-2-yl]acetamide |
|---|---|
| PubChem CID | 86685890 |
| Molecular Formula | C29H27F6NO4 |
| Molecular Weight | 567.53 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | 2-phenoxy-N-[(2S)-1,1,1-trifluoro-4-(4-methylphenyl)-4-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]butan-2-yl]acetamide |
| SMILES | Cc1ccc(C(=O)C[C@](NC(=O)COc2ccccc2)(c2ccc(OCCCC(F)(F)F)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H27F6NO4/c1-20-8-10-21(11-9-20)25(37)18-27(29(33,34)35,36-26(38)19-40-23-6-3-2-4-7-23)22-12-14-24(15-13-22)39-17-5-16-28(30,31)32/h2-4,6-15H,5,16-19H2,1H3,(H,36,38)/t27-/m0/s1 |
| InChIKey | QSUWCMJTBADZRP-MHZLTWQESA-N |
| XLogP | 6.94 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.53 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|