C23H25F6NO2 — CID 86685860
(3S)-3-amino-4,4,4-trifluoro-1-(4-methylphenyl)-3-[4-(6,6,6-trifluorohexoxy)phenyl]butan-1-one (PubChem CID 86685860) has the molecular formula C23H25F6NO2 and a molecular weight of 461.45 g/mol. Its IUPAC name is (3S)-3-amino-4,4,4-trifluoro-1-(4-methylphenyl)-3-[4-(6,6,6-trifluorohexoxy)phenyl]butan-1-one.
| Compound Name | (3S)-3-amino-4,4,4-trifluoro-1-(4-methylphenyl)-3-[4-(6,6,6-trifluorohexoxy)phenyl]butan-1-one |
|---|---|
| PubChem CID | 86685860 |
| Molecular Formula | C23H25F6NO2 |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | (3S)-3-amino-4,4,4-trifluoro-1-(4-methylphenyl)-3-[4-(6,6,6-trifluorohexoxy)phenyl]butan-1-one |
| SMILES | Cc1ccc(C(=O)C[C@](N)(c2ccc(OCCCCCC(F)(F)F)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H25F6NO2/c1-16-5-7-17(8-6-16)20(31)15-21(30,23(27,28)29)18-9-11-19(12-10-18)32-14-4-2-3-13-22(24,25)26/h5-12H,2-4,13-15,30H2,1H3/t21-/m0/s1 |
| InChIKey | PCVGKUQQJPUHES-NRFANRHFSA-N |
| XLogP | 6.49 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|