C23H27F3O2 — CID 163520243
(3S)-1-(4-methylphenyl)-3-[4-(6,6,6-trifluorohexoxy)phenyl]butan-1-one (PubChem CID 163520243) has the molecular formula C23H27F3O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is (3S)-1-(4-methylphenyl)-3-[4-(6,6,6-trifluorohexoxy)phenyl]butan-1-one.
| Compound Name | (3S)-1-(4-methylphenyl)-3-[4-(6,6,6-trifluorohexoxy)phenyl]butan-1-one |
|---|---|
| PubChem CID | 163520243 |
| Molecular Formula | C23H27F3O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | (3S)-1-(4-methylphenyl)-3-[4-(6,6,6-trifluorohexoxy)phenyl]butan-1-one |
| SMILES | Cc1ccc(C(=O)C[C@H](C)c2ccc(OCCCCCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H27F3O2/c1-17-6-8-20(9-7-17)22(27)16-18(2)19-10-12-21(13-11-19)28-15-5-3-4-14-23(24,25)26/h6-13,18H,3-5,14-16H2,1-2H3/t18-/m0/s1 |
| InChIKey | DKEQOGVQAUJGHR-SFHVURJKSA-N |
| XLogP | 6.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|