C24H25F3O4 — CID 76774089
ethyl 3-[4-[2-[4-(5,5,5-trifluoropentoxy)phenyl]acetyl]phenyl]prop-2-enoate (PubChem CID 76774089) has the molecular formula C24H25F3O4 and a molecular weight of 434.45 g/mol. Its IUPAC name is ethyl 3-[4-[2-[4-(5,5,5-trifluoropentoxy)phenyl]acetyl]phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[4-[2-[4-(5,5,5-trifluoropentoxy)phenyl]acetyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 76774089 |
| Molecular Formula | C24H25F3O4 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | ethyl 3-[4-[2-[4-(5,5,5-trifluoropentoxy)phenyl]acetyl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc(C(=O)Cc2ccc(OCCCCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H25F3O4/c1-2-30-23(29)14-9-18-5-10-20(11-6-18)22(28)17-19-7-12-21(13-8-19)31-16-4-3-15-24(25,26)27/h5-14H,2-4,15-17H2,1H3 |
| InChIKey | JTJWHIJRODFJJQ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|