C35H39F3N2O6 — CID 123907767
6-[3-[4-[2-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]ethyl]phenyl]prop-2-enoyloxy]hexyl 3,5-diamino-4-methylbenzoate (PubChem CID 123907767) has the molecular formula C35H39F3N2O6 and a molecular weight of 640.70 g/mol. Its IUPAC name is 6-[3-[4-[2-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]ethyl]phenyl]prop-2-enoyloxy]hexyl 3,5-diamino-4-methylbenzoate.
| Compound Name | 6-[3-[4-[2-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]ethyl]phenyl]prop-2-enoyloxy]hexyl 3,5-diamino-4-methylbenzoate |
|---|---|
| PubChem CID | 123907767 |
| Molecular Formula | C35H39F3N2O6 |
| Molecular Weight | 640.70 g/mol |
| Exact Mass | 640.28 |
| IUPAC Name | 6-[3-[4-[2-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]ethyl]phenyl]prop-2-enoyloxy]hexyl 3,5-diamino-4-methylbenzoate |
| SMILES | Cc1c(N)cc(C(=O)OCCCCCCOC(=O)C=Cc2ccc(CC(=O)c3ccc(OCCCC(F)(F)F)cc3)cc2)cc1N |
| InChI | InChI=1S/C35H39F3N2O6/c1-24-30(39)22-28(23-31(24)40)34(43)46-19-5-3-2-4-18-45-33(42)16-11-25-7-9-26(10-8-25)21-32(41)27-12-14-29(15-13-27)44-20-6-17-35(36,37)38/h7-16,22-23H,2-6,17-21,39-40H2,1H3 |
| InChIKey | YHODINKJQAAQKU-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 130.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.70 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|