C33H35F5N2O5 — CID 89401456
4-[(E)-3-[4-[difluoro-[4-(6,6,6-trifluorohexyl)phenyl]methoxy]phenyl]prop-2-enoyl]oxybutyl 3,5-diaminobenzoate (PubChem CID 89401456) has the molecular formula C33H35F5N2O5 and a molecular weight of 634.64 g/mol. Its IUPAC name is 4-[(E)-3-[4-[difluoro-[4-(6,6,6-trifluorohexyl)phenyl]methoxy]phenyl]prop-2-enoyl]oxybutyl 3,5-diaminobenzoate.
| Compound Name | 4-[(E)-3-[4-[difluoro-[4-(6,6,6-trifluorohexyl)phenyl]methoxy]phenyl]prop-2-enoyl]oxybutyl 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 89401456 |
| Molecular Formula | C33H35F5N2O5 |
| Molecular Weight | 634.64 g/mol |
| Exact Mass | 634.25 |
| IUPAC Name | 4-[(E)-3-[4-[difluoro-[4-(6,6,6-trifluorohexyl)phenyl]methoxy]phenyl]prop-2-enoyl]oxybutyl 3,5-diaminobenzoate |
| SMILES | Nc1cc(N)cc(C(=O)OCCCCOC(=O)/C=C/c2ccc(OC(F)(F)c3ccc(CCCCCC(F)(F)F)cc3)cc2)c1 |
| InChI | InChI=1S/C33H35F5N2O5/c34-32(35,36)17-3-1-2-6-23-7-12-26(13-8-23)33(37,38)45-29-14-9-24(10-15-29)11-16-30(41)43-18-4-5-19-44-31(42)25-20-27(39)22-28(40)21-25/h7-16,20-22H,1-6,17-19,39-40H2/b16-11+ |
| InChIKey | NJHZGFJLGFPJAM-LFIBNONCSA-N |
| XLogP | 7.84 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.64 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|