C21H19F5O3 — CID 89400808
(E)-3-[4-[difluoro-[4-(5,5,5-trifluoropentyl)phenyl]methoxy]phenyl]prop-2-enoic acid (PubChem CID 89400808) has the molecular formula C21H19F5O3 and a molecular weight of 414.37 g/mol. Its IUPAC name is (E)-3-[4-[difluoro-[4-(5,5,5-trifluoropentyl)phenyl]methoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[difluoro-[4-(5,5,5-trifluoropentyl)phenyl]methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 89400808 |
| Molecular Formula | C21H19F5O3 |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | (E)-3-[4-[difluoro-[4-(5,5,5-trifluoropentyl)phenyl]methoxy]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(OC(F)(F)c2ccc(CCCCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H19F5O3/c22-20(23,24)14-2-1-3-15-4-9-17(10-5-15)21(25,26)29-18-11-6-16(7-12-18)8-13-19(27)28/h4-13H,1-3,14H2,(H,27,28)/b13-8+ |
| InChIKey | WESIIJSIVHCPJC-MDWZMJQESA-N |
| XLogP | 6.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|