C20H23F5O3 — CID 123136504
3-[4-[difluoro-[4-(4,4,4-trifluorobutyl)cyclohexyl]methoxy]phenyl]prop-2-enoic acid (PubChem CID 123136504) has the molecular formula C20H23F5O3 and a molecular weight of 406.39 g/mol. Its IUPAC name is 3-[4-[difluoro-[4-(4,4,4-trifluorobutyl)cyclohexyl]methoxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[difluoro-[4-(4,4,4-trifluorobutyl)cyclohexyl]methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123136504 |
| Molecular Formula | C20H23F5O3 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 3-[4-[difluoro-[4-(4,4,4-trifluorobutyl)cyclohexyl]methoxy]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(OC(F)(F)C2CCC(CCCC(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C20H23F5O3/c21-19(22,23)13-1-2-14-3-8-16(9-4-14)20(24,25)28-17-10-5-15(6-11-17)7-12-18(26)27/h5-7,10-12,14,16H,1-4,8-9,13H2,(H,26,27) |
| InChIKey | MFOCGXZMBPMXMF-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|