C17H17F3O4 — CID 68611160
(E)-3-[4-[4-(trifluoromethyl)cyclohexanecarbonyl]oxyphenyl]prop-2-enoic acid (PubChem CID 68611160) has the molecular formula C17H17F3O4 and a molecular weight of 342.31 g/mol. Its IUPAC name is (E)-3-[4-[4-(trifluoromethyl)cyclohexanecarbonyl]oxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[4-(trifluoromethyl)cyclohexanecarbonyl]oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68611160 |
| Molecular Formula | C17H17F3O4 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | (E)-3-[4-[4-(trifluoromethyl)cyclohexanecarbonyl]oxyphenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(OC(=O)C2CCC(C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C17H17F3O4/c18-17(19,20)13-6-4-12(5-7-13)16(23)24-14-8-1-11(2-9-14)3-10-15(21)22/h1-3,8-10,12-13H,4-7H2,(H,21,22)/b10-3+ |
| InChIKey | OZHYFJWMZOWZIT-XCVCLJGOSA-N |
| XLogP | 4.06 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|