C23H29F3O4 — CID 91549658
[4-(3-hexoxy-3-oxoprop-1-enyl)phenyl] 4-(trifluoromethyl)cyclohexane-1-carboxylate (PubChem CID 91549658) has the molecular formula C23H29F3O4 and a molecular weight of 426.48 g/mol. Its IUPAC name is [4-(3-hexoxy-3-oxoprop-1-enyl)phenyl] 4-(trifluoromethyl)cyclohexane-1-carboxylate.
| Compound Name | [4-(3-hexoxy-3-oxoprop-1-enyl)phenyl] 4-(trifluoromethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 91549658 |
| Molecular Formula | C23H29F3O4 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | [4-(3-hexoxy-3-oxoprop-1-enyl)phenyl] 4-(trifluoromethyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCCOC(=O)C=Cc1ccc(OC(=O)C2CCC(C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C23H29F3O4/c1-2-3-4-5-16-29-21(27)15-8-17-6-13-20(14-7-17)30-22(28)18-9-11-19(12-10-18)23(24,25)26/h6-8,13-15,18-19H,2-5,9-12,16H2,1H3 |
| InChIKey | XOSZTAVJTWJDLO-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|