C30H40N2O5 — CID 68612656
[4-[(E)-3-[2-(3,5-diaminophenyl)propoxy]-3-oxoprop-1-enyl]phenyl] 4-pentoxycyclohexane-1-carboxylate (PubChem CID 68612656) has the molecular formula C30H40N2O5 and a molecular weight of 508.66 g/mol. Its IUPAC name is [4-[(E)-3-[2-(3,5-diaminophenyl)propoxy]-3-oxoprop-1-enyl]phenyl] 4-pentoxycyclohexane-1-carboxylate.
| Compound Name | [4-[(E)-3-[2-(3,5-diaminophenyl)propoxy]-3-oxoprop-1-enyl]phenyl] 4-pentoxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 68612656 |
| Molecular Formula | C30H40N2O5 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | [4-[(E)-3-[2-(3,5-diaminophenyl)propoxy]-3-oxoprop-1-enyl]phenyl] 4-pentoxycyclohexane-1-carboxylate |
| SMILES | CCCCCOC1CCC(C(=O)Oc2ccc(/C=C/C(=O)OCC(C)c3cc(N)cc(N)c3)cc2)CC1 |
| InChI | InChI=1S/C30H40N2O5/c1-3-4-5-16-35-27-13-9-23(10-14-27)30(34)37-28-11-6-22(7-12-28)8-15-29(33)36-20-21(2)24-17-25(31)19-26(32)18-24/h6-8,11-12,15,17-19,21,23,27H,3-5,9-10,13-14,16,20,31-32H2,1-2H3/b15-8+ |
| InChIKey | TXVASIUIKJAOAT-OVCLIPMQSA-N |
| XLogP | 5.88 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|