C26H29F3N2O5 — CID 68610492
[4-[3-[2-(3,5-diaminophenyl)propoxy]-3-oxoprop-1-enyl]phenyl] 4-(trifluoromethoxy)cyclohexane-1-carboxylate (PubChem CID 68610492) has the molecular formula C26H29F3N2O5 and a molecular weight of 506.52 g/mol. Its IUPAC name is [4-[3-[2-(3,5-diaminophenyl)propoxy]-3-oxoprop-1-enyl]phenyl] 4-(trifluoromethoxy)cyclohexane-1-carboxylate.
| Compound Name | [4-[3-[2-(3,5-diaminophenyl)propoxy]-3-oxoprop-1-enyl]phenyl] 4-(trifluoromethoxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 68610492 |
| Molecular Formula | C26H29F3N2O5 |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | [4-[3-[2-(3,5-diaminophenyl)propoxy]-3-oxoprop-1-enyl]phenyl] 4-(trifluoromethoxy)cyclohexane-1-carboxylate |
| SMILES | CC(COC(=O)C=Cc1ccc(OC(=O)C2CCC(OC(F)(F)F)CC2)cc1)c1cc(N)cc(N)c1 |
| InChI | InChI=1S/C26H29F3N2O5/c1-16(19-12-20(30)14-21(31)13-19)15-34-24(32)11-4-17-2-7-22(8-3-17)35-25(33)18-5-9-23(10-6-18)36-26(27,28)29/h2-4,7-8,11-14,16,18,23H,5-6,9-10,15,30-31H2,1H3 |
| InChIKey | NHMXZYNFFFDEPH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|