C27H34N2O5 — CID 68610772
[4-[(E)-3-[2-(2,4-diaminophenyl)-2-methylpropoxy]-3-oxoprop-1-enyl]phenyl] 4-methoxycyclohexane-1-carboxylate (PubChem CID 68610772) has the molecular formula C27H34N2O5 and a molecular weight of 466.58 g/mol. Its IUPAC name is [4-[(E)-3-[2-(2,4-diaminophenyl)-2-methylpropoxy]-3-oxoprop-1-enyl]phenyl] 4-methoxycyclohexane-1-carboxylate.
| Compound Name | [4-[(E)-3-[2-(2,4-diaminophenyl)-2-methylpropoxy]-3-oxoprop-1-enyl]phenyl] 4-methoxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 68610772 |
| Molecular Formula | C27H34N2O5 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | [4-[(E)-3-[2-(2,4-diaminophenyl)-2-methylpropoxy]-3-oxoprop-1-enyl]phenyl] 4-methoxycyclohexane-1-carboxylate |
| SMILES | COC1CCC(C(=O)Oc2ccc(/C=C/C(=O)OCC(C)(C)c3ccc(N)cc3N)cc2)CC1 |
| InChI | InChI=1S/C27H34N2O5/c1-27(2,23-14-9-20(28)16-24(23)29)17-33-25(30)15-6-18-4-10-22(11-5-18)34-26(31)19-7-12-21(32-3)13-8-19/h4-6,9-11,14-16,19,21H,7-8,12-13,17,28-29H2,1-3H3/b15-6+ |
| InChIKey | PRSRXKZBXIEPKW-GIDUJCDVSA-N |
| XLogP | 4.50 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|