C17H19NO6 — CID 129147098
[4-[(E)-3-nitro-3-oxoprop-1-enyl]phenyl] 4-methoxycyclohexane-1-carboxylate (PubChem CID 129147098) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is [4-[(E)-3-nitro-3-oxoprop-1-enyl]phenyl] 4-methoxycyclohexane-1-carboxylate.
| Compound Name | [4-[(E)-3-nitro-3-oxoprop-1-enyl]phenyl] 4-methoxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 129147098 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | [4-[(E)-3-nitro-3-oxoprop-1-enyl]phenyl] 4-methoxycyclohexane-1-carboxylate |
| SMILES | COC1CCC(C(=O)Oc2ccc(/C=C/C(=O)[N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C17H19NO6/c1-23-14-9-5-13(6-10-14)17(20)24-15-7-2-12(3-8-15)4-11-16(19)18(21)22/h2-4,7-8,11,13-14H,5-6,9-10H2,1H3/b11-4+ |
| InChIKey | MLRXPWZSRGPOCU-NYYWCZLTSA-N |
| XLogP | 2.61 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|