C29H34O8 — CID 163885438
[4-[4-(4-methoxycyclohexanecarbonyl)oxycyclohexanecarbonyl]oxyphenyl] 4-methoxybenzoate (PubChem CID 163885438) has the molecular formula C29H34O8 and a molecular weight of 510.58 g/mol. Its IUPAC name is [4-[4-(4-methoxycyclohexanecarbonyl)oxycyclohexanecarbonyl]oxyphenyl] 4-methoxybenzoate.
| Compound Name | [4-[4-(4-methoxycyclohexanecarbonyl)oxycyclohexanecarbonyl]oxyphenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 163885438 |
| Molecular Formula | C29H34O8 |
| Molecular Weight | 510.58 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | [4-[4-(4-methoxycyclohexanecarbonyl)oxycyclohexanecarbonyl]oxyphenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(OC(=O)C3CCC(OC(=O)C4CCC(OC)CC4)CC3)cc2)cc1 |
| InChI | InChI=1S/C29H34O8/c1-33-22-9-3-19(4-10-22)27(30)35-24-13-7-21(8-14-24)29(32)37-26-17-15-25(16-18-26)36-28(31)20-5-11-23(34-2)12-6-20/h5-6,11-12,15-19,21-22,24H,3-4,7-10,13-14H2,1-2H3 |
| InChIKey | PWXTXYXBHUHMBJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.58 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|