C22H28N2O8 — CID 163769646
(4-aminooxycarbonylcyclohexyl) 4-(4-carbamoyloxycyclohexanecarbonyl)oxybenzoate (PubChem CID 163769646) has the molecular formula C22H28N2O8 and a molecular weight of 448.47 g/mol. Its IUPAC name is (4-aminooxycarbonylcyclohexyl) 4-(4-carbamoyloxycyclohexanecarbonyl)oxybenzoate.
| Compound Name | (4-aminooxycarbonylcyclohexyl) 4-(4-carbamoyloxycyclohexanecarbonyl)oxybenzoate |
|---|---|
| PubChem CID | 163769646 |
| Molecular Formula | C22H28N2O8 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | (4-aminooxycarbonylcyclohexyl) 4-(4-carbamoyloxycyclohexanecarbonyl)oxybenzoate |
| SMILES | NOC(=O)C1CCC(OC(=O)c2ccc(OC(=O)C3CCC(OC(N)=O)CC3)cc2)CC1 |
| InChI | InChI=1S/C22H28N2O8/c23-22(28)31-18-11-3-14(4-12-18)20(26)29-16-7-1-13(2-8-16)19(25)30-17-9-5-15(6-10-17)21(27)32-24/h1-2,7-8,14-15,17-18H,3-6,9-12,24H2,(H2,23,28) |
| InChIKey | MFHWGXRPJODRSP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 157.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|