C22H24O7 — CID 134467382
(4-methoxyphenyl) 4-[4-(dihydroxymethyl)cyclohexanecarbonyl]oxybenzoate (PubChem CID 134467382) has the molecular formula C22H24O7 and a molecular weight of 400.43 g/mol. Its IUPAC name is (4-methoxyphenyl) 4-[4-(dihydroxymethyl)cyclohexanecarbonyl]oxybenzoate.
| Compound Name | (4-methoxyphenyl) 4-[4-(dihydroxymethyl)cyclohexanecarbonyl]oxybenzoate |
|---|---|
| PubChem CID | 134467382 |
| Molecular Formula | C22H24O7 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (4-methoxyphenyl) 4-[4-(dihydroxymethyl)cyclohexanecarbonyl]oxybenzoate |
| SMILES | COc1ccc(OC(=O)c2ccc(OC(=O)C3CCC(C(O)O)CC3)cc2)cc1 |
| InChI | InChI=1S/C22H24O7/c1-27-17-10-12-19(13-11-17)29-22(26)16-6-8-18(9-7-16)28-21(25)15-4-2-14(3-5-15)20(23)24/h6-15,20,23-24H,2-5H2,1H3 |
| InChIKey | LFGYEMHOPWDWRI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|