C22H26O6 — CID 163462511
[4-[hydroxy-(4-methoxyphenyl)methoxy]phenyl] 4-methoxycyclohexane-1-carboxylate (PubChem CID 163462511) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is [4-[hydroxy-(4-methoxyphenyl)methoxy]phenyl] 4-methoxycyclohexane-1-carboxylate.
| Compound Name | [4-[hydroxy-(4-methoxyphenyl)methoxy]phenyl] 4-methoxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 163462511 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | [4-[hydroxy-(4-methoxyphenyl)methoxy]phenyl] 4-methoxycyclohexane-1-carboxylate |
| SMILES | COc1ccc(C(O)Oc2ccc(OC(=O)C3CCC(OC)CC3)cc2)cc1 |
| InChI | InChI=1S/C22H26O6/c1-25-17-7-3-15(4-8-17)21(23)27-19-11-13-20(14-12-19)28-22(24)16-5-9-18(26-2)10-6-16/h3-4,7-8,11-14,16,18,21,23H,5-6,9-10H2,1-2H3 |
| InChIKey | BPULUNDOYDBWOS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|