C26H32O5 — CID 70387000
[(2S)-2-methylbutyl] 4-[4-(4-methoxycyclohexanecarbonyl)oxyphenyl]benzoate (PubChem CID 70387000) has the molecular formula C26H32O5 and a molecular weight of 424.54 g/mol. Its IUPAC name is [(2S)-2-methylbutyl] 4-[4-(4-methoxycyclohexanecarbonyl)oxyphenyl]benzoate.
| Compound Name | [(2S)-2-methylbutyl] 4-[4-(4-methoxycyclohexanecarbonyl)oxyphenyl]benzoate |
|---|---|
| PubChem CID | 70387000 |
| Molecular Formula | C26H32O5 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | [(2S)-2-methylbutyl] 4-[4-(4-methoxycyclohexanecarbonyl)oxyphenyl]benzoate |
| SMILES | CC[C@H](C)COC(=O)c1ccc(-c2ccc(OC(=O)C3CCC(OC)CC3)cc2)cc1 |
| InChI | InChI=1S/C26H32O5/c1-4-18(2)17-30-25(27)21-7-5-19(6-8-21)20-9-15-24(16-10-20)31-26(28)22-11-13-23(29-3)14-12-22/h5-10,15-16,18,22-23H,4,11-14,17H2,1-3H3/t18-,22?,23?/m0/s1 |
| InChIKey | VYDXLOGAALQJPE-NWLLBJEDSA-N |
| XLogP | 5.67 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|