C24H29N3O4 — CID 15549899
ethyl 4-[4-[4-[(diaminomethylideneamino)methyl]cyclohexanecarbonyl]oxyphenyl]benzoate (PubChem CID 15549899) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is ethyl 4-[4-[4-[(diaminomethylideneamino)methyl]cyclohexanecarbonyl]oxyphenyl]benzoate.
| Compound Name | ethyl 4-[4-[4-[(diaminomethylideneamino)methyl]cyclohexanecarbonyl]oxyphenyl]benzoate |
|---|---|
| PubChem CID | 15549899 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | ethyl 4-[4-[4-[(diaminomethylideneamino)methyl]cyclohexanecarbonyl]oxyphenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(OC(=O)C3CCC(CN=C(N)N)CC3)cc2)cc1 |
| InChI | InChI=1S/C24H29N3O4/c1-2-30-22(28)19-9-7-17(8-10-19)18-11-13-21(14-12-18)31-23(29)20-5-3-16(4-6-20)15-27-24(25)26/h7-14,16,20H,2-6,15H2,1H3,(H4,25,26,27) |
| InChIKey | UCPQWOWHGWNBQZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|