C18H28N4O4 — CID 158025102
[4-[3-(hydroxyamino)-3-oxopropyl]phenyl] 4-[(diaminomethylideneamino)methyl]cyclohexane-1-carboxylate;molecular hydrogen (PubChem CID 158025102) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is [4-[3-(hydroxyamino)-3-oxopropyl]phenyl] 4-[(diaminomethylideneamino)methyl]cyclohexane-1-carboxylate;molecular hydrogen.
| Compound Name | [4-[3-(hydroxyamino)-3-oxopropyl]phenyl] 4-[(diaminomethylideneamino)methyl]cyclohexane-1-carboxylate;molecular hydrogen |
|---|---|
| PubChem CID | 158025102 |
| Molecular Formula | C18H28N4O4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | [4-[3-(hydroxyamino)-3-oxopropyl]phenyl] 4-[(diaminomethylideneamino)methyl]cyclohexane-1-carboxylate;molecular hydrogen |
| SMILES | NC(N)=NCC1CCC(C(=O)Oc2ccc(CCC(=O)NO)cc2)CC1.[H][H] |
| InChI | InChI=1S/C18H26N4O4.H2/c19-18(20)21-11-13-1-6-14(7-2-13)17(24)26-15-8-3-12(4-9-15)5-10-16(23)22-25;/h3-4,8-9,13-14,25H,1-2,5-7,10-11H2,(H,22,23)(H4,19,20,21);1H |
| InChIKey | FGNAPMKIAFVFSL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|