C23H27N3O7S — CID 20745105
4-[4-[4-[(diaminomethylideneamino)methyl]cyclohexanecarbonyl]oxyphenyl]-2-(sulfomethyl)benzoic acid (PubChem CID 20745105) has the molecular formula C23H27N3O7S and a molecular weight of 489.55 g/mol. Its IUPAC name is 4-[4-[4-[(diaminomethylideneamino)methyl]cyclohexanecarbonyl]oxyphenyl]-2-(sulfomethyl)benzoic acid.
| Compound Name | 4-[4-[4-[(diaminomethylideneamino)methyl]cyclohexanecarbonyl]oxyphenyl]-2-(sulfomethyl)benzoic acid |
|---|---|
| PubChem CID | 20745105 |
| Molecular Formula | C23H27N3O7S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 4-[4-[4-[(diaminomethylideneamino)methyl]cyclohexanecarbonyl]oxyphenyl]-2-(sulfomethyl)benzoic acid |
| SMILES | NC(N)=NCC1CCC(C(=O)Oc2ccc(-c3ccc(C(=O)O)c(CS(=O)(=O)O)c3)cc2)CC1 |
| InChI | InChI=1S/C23H27N3O7S/c24-23(25)26-12-14-1-3-16(4-2-14)22(29)33-19-8-5-15(6-9-19)17-7-10-20(21(27)28)18(11-17)13-34(30,31)32/h5-11,14,16H,1-4,12-13H2,(H,27,28)(H4,24,25,26)(H,30,31,32) |
| InChIKey | SORUKEKBPUVPGT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 182.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|